| Material Name: | DAF-1 | ||||
Chemical Formula: |
|(DecM+2)7 (H2O)40 | [Mg14Al52P66O264]-DFO DecM+2 = C16H38N2+2 = decamethonium ion = trimethyl-[10-(trimethylazaniumyl)decyl]azanium SMILES: C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C Images: stick or |
||||
| Unit Cell: |
hexagonal |
P 6/m m m (# 191) |
|||
| a' = 22.3510 Å | b' = 22.3510 Å | c' = 21.6930 Å | |||
| α' = 90.000° | β' = 90.000° | γ' = 120.000° | |||
| Framework Density: |
14.1 T/1000 Å3 |
||||
| |
Channels: |
{[001] 12 7.3 x 7.3 <->
| |||||||||||
| Stability: |
Transforms to AlPO4-5 and AlPO4-tridymite on heating to 500ÂșC |
||||||||||||
| The additional references point to more recent (better) refinements and/or better (purer) Materials |
| |
Name and Code derivation: |
|
|
Davy Faraday Research Laboratory - one DAF-1 (one) DFO | ||
| Limiting Rings | |
|
|
12-ring viewed along [001] | 8-ring viewed normal to [001] |
|
|
2nd 12-ring viewed along [001] | 10-ring viewed normal to [001] |