| Material Name: | ITQ-13 | ||||
Chemical Formula: |
|(HM+2)2 F4| [Si56O112]-ITH HM+2 = C12H30N2+2 = hexamethonium ion = trimethyl-[6-(trimethylazaniumyl)hexyl]azanium SMILES: C[N+](C)(C)CCCCCC[N+](C)(C)C Images: stick or |
||||
| Unit Cell: |
orthorhombic |
A m m 2 (# 38) |
|||
| a' = 12.5250 Å | b' = 11.3910 Å | c' = 22.0530 Å | |||
| α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
| Framework Density: |
17.8 T/1000 Å3 |
||||
| |
Channels: |
[001] 10 4.8 x 5.3* <-> [010] 10 4.8 x 5.1* <-> [100] 9 4.0 x 4.8*
| |||||||||||
| The additional references point to more recent (better) refinements and/or better (purer) Materials |
| |
Name and Code derivation: |
|
|
Instituto de Tecnologia Quimica Valencia - thirteen ITQ-13 (thirteen) ITH | ||
| Limiting Rings | |
|
|
10-ring viewed along [001] | 10-ring viewed along [010] |
|
|
9-ring viewed along [100] | |