Material Name: | ITQ-37 | ||||
Chemical Formula: |
|TEDATD+2 (H2O)10.5| [Ge80Si112O368OH32]--ITV TEDATD+2 = C22H40N2+2 = 4,4,10,10-Tetraethyl-1,14-dimethyl-4,10-diazoniatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene SMILES: CC[N+]1(CC2C(C1)C3(C=C(C2C4C3C[N+](C4)(CC)CC)C)C)CC Images: stick or 3D |
||||
Unit Cell: |
cubic |
P 41 3 2 (# 213) |
|||
a' = 26.5126 Å | b' = 26.5126 Å | c' = 26.5126 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
Framework Density: |
10.3 T/1000 Å3 |
|
Channels: |
| |||||||||||
Stability: |
stable to calcination in a dry atmosphere |
References: |
|||
Sun, J., Bonneau, C., Cantin, A., Corma, A., Díaz-Cabañas, M.J., Moliner, M., Zhang, D., Li, M. and Zou, X. | |||
"The ITQ-37 mesoporous chiral zeolite" | |||
Nature, 458, 1154-1157 (2009) |
|
Name and Code derivation: |
|
Instituto de Tecnologia Quimica Valencia - thirty-seven ITQ-37 (thirty-seven) -ITV |