| *ITQ-53, as-made | ||||
| Yun, Y., Hernandez, M., Wan, W., Zou, X., Jorda, J.L., Cantin, A., Rey, F. and Corma, A. The first zeolite with a tridirectional extra-large 14-ring pore system derived using a phosponium-based organic molecule Chem. Commun., 51, 7602-7605 (2015) |
|(TBMP+)16 F16 (H2O)9.4416 | [Ge71.6Si80.4O300(OH)8]--IFT TBMP+ = C13H30P+ = tri-tertbutylmethylphosphonium ion = Tritert-butyl(methyl)phosphanium SMILES: CC(C)(C)[P+](C)(C(C)(C)C)C(C)(C)C Images: stick or | |||
| Search for more -IFT references with Google Scholar |
| * | The Reference Material is indicated with an asterisk (*). |