| CIT-13 | ||||
| Refinement shows that the two d4r unit positions are equally occupied | ||||
| Kang, J.H., Xie, D., Zones, S.I., Smeets, S., McCusker, L.B. and Davis, M.E. Synthesis and characterization of CIT-13, a germanosilicate molecular sieve with extra-large pore openings Chem. Mater., 28,6250-6259 (2016) |
|(DMMBI+)6.6F4| [Si108.68Ge19.32O256] DMMBI+ = C13H17N2+ = 1,2-dimethyl-3-(3-methylbenzyl)imidazolium ion = 1,2-dimethyl-3-[(3-methylphenyl)methyl]imidazol-1-ium SMILES: CC1=CC(=CC=C1)CN2C=C[N+](=C2C)C Images: stick or | |||
| NUD-2 | ||||
| Gao, Z.-H., Chen, F.-J., Xu, L., Sun, L., Xu, Y. and Du, H.-B. A stable extra-large-pore zeolite with intersecting 14- and 10-membered-ring channels Chem. Eur. J., 22,14367-14372 (2016) |
[Ge8Si56O128] | |||
| SAZ-1 | ||||
| Firth, D.S., Morris, A.A., Wheatley, P.S., Russell, S.E., Slawin, A.M.Z., Dawson, D.M., Mayoral, A., Opanasenko, M., Polozij, M., Čejka, J., Tachtigall, P. and Morris, R.E. Assembly–Disassembly–Organization–Reassembly synthesis of zeolites based on cfi-type layers Chem. Mater., 29,5605-5611 (2017) |
[Ge - Si - O] | |||